| MolName | (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-[2-(trifluoromethyl)phenyl]methanimine |
| MolecularFormula | C19H19N3ClF3 |
| Smiles | FC(c1c(/C=N\N2CCN(Cc(cccc3)c3Cl)CC2)cccc1)(F)F |
| InChI | InChI=1S/C19H19ClF3N3/c20-18-8-4-2-6-16(18)14-25-9-11-26(12-10-25)24-13-15-5-1-3-7-17(15)19(21,22)23/h1-8,13H,9-12,14H2 |
| InChIK | RKVOPXLPFFUWDS-UHFFFAOYSA-N |
| TotalMolweight | 381.828 |
| Molweight | 381.828 |
| MonoisotopicMass | 381.121958 |
| CLogP | 4.4733 |
| CLogS | -4.17 |
| H Acceptors | 3 |
| TotalSurfaceArea | 278.56 |
| Relative PSA | 0.066808 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | -0.053472 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-[2-(trifluoromethyl)phenyl]methanimine | 2 - (Z)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-1-[2-(trifluoromethyl)phenyl]methanimine