| MolName | N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide |
| MolecularFormula | C19H14N3O4Cl |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1-c1ccc(/C=N\NC(Cc2ccccc2)=O)o1)=O |
| InChI | InChI=1S/C19H14ClN3O4/c20-17-11-14(23(25)26)6-8-16(17)18-9-7-15(27-18)12-21-22-19(24)10-13-4-2-1-3-5-13/h1-9,11-12H,10H2,(H,22,24) |
| InChIK | RLALFRCVMDFTSD-UHFFFAOYSA-N |
| TotalMolweight | 383.79 |
| Molweight | 383.79 |
| MonoisotopicMass | 383.067284 |
| CLogP | 3.823 |
| CLogS | -6.342 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 289.29 |
| Relative PSA | 0.27841 |
| PolarSurfaceArea | 100.42 |
| Druglikeness | 1.4324 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide