| MolName | 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C22H23N7O4 |
| Smiles | OC(COc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(Nc3ccccc3)n2)cc1)=O |
| InChI | InChI=1S/C22H23N7O4/c30-19(31)15-33-18-8-6-16(7-9-18)14-23-28-21-25-20(24-17-4-2-1-3-5-17)26-22(27-21)29-10-12-32-13-11-29/h1-9,14H,10-13,15H2,(H,30,31)(H2,24,25,26,27,28) |
| InChIK | RLKMZUCPLYLWBB-UHFFFAOYSA-N |
| TotalMolweight | 449.47 |
| Molweight | 449.47 |
| MonoisotopicMass | 449.181153 |
| CLogP | 4.0107 |
| CLogS | -4.809 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 346.44 |
| Relative PSA | 0.33781 |
| PolarSurfaceArea | 134.09 |
| Druglikeness | 3.5626 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid