| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C15H19N3O2 |
| Smiles | O=C(C1CC1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H19N3O2/c19-15(13-3-4-13)17-16-11-12-1-5-14(6-2-12)18-7-9-20-10-8-18/h1-2,5-6,11,13H,3-4,7-10H2,(H,17,19) |
| InChIK | RLSRCVDTPCBSRR-UHFFFAOYSA-N |
| TotalMolweight | 273.335 |
| Molweight | 273.335 |
| MonoisotopicMass | 273.147727 |
| CLogP | 1.7449 |
| CLogS | -3.17 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 215.59 |
| Relative PSA | 0.22988 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 6.2406 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]cyclopropanecarboxamide