| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C24H18N6O5S |
| Smiles | [O-][N+](c1cccc(-c(n2-c3ccccc3)nnc2SCC(N/N=C\c(cc2)cc3c2OCO3)=O)c1)=O |
| InChI | InChI=1S/C24H18N6O5S/c31-22(26-25-13-16-9-10-20-21(11-16)35-15-34-20)14-36-24-28-27-23(29(24)18-6-2-1-3-7-18)17-5-4-8-19(12-17)30(32)33/h1-13H,14-15H2,(H,26,31) |
| InChIK | RLYQXGJKVZTPQE-UHFFFAOYSA-N |
| TotalMolweight | 502.51 |
| Molweight | 502.51 |
| MonoisotopicMass | 502.105939 |
| CLogP | 3.7216 |
| CLogS | -9.587 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 368.41 |
| Relative PSA | 0.36028 |
| PolarSurfaceArea | 161.75 |
| Druglikeness | 0.20211 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide