| MolName | 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H20N7Cl2F |
| Smiles | Fc(cc1)ccc1Nc1nc(N/N=C\c2cccc(Cl)c2Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C21H20Cl2FN7/c22-17-6-4-5-14(18(17)23)13-25-30-20-27-19(26-16-9-7-15(24)8-10-16)28-21(29-20)31-11-2-1-3-12-31/h4-10,13H,1-3,11-12H2,(H2,26,27,28,29,30) |
| InChIK | RMCHJANYBAFWDH-UHFFFAOYSA-N |
| TotalMolweight | 460.343 |
| Molweight | 460.343 |
| MonoisotopicMass | 459.114125 |
| CLogP | 7.9387 |
| CLogS | -7.691 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 339.53 |
| Relative PSA | 0.20879 |
| PolarSurfaceArea | 78.33 |
| Druglikeness | 1.6048 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine