| MolName | 3-[4-(2-phenylethoxy)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C27H24N4O2 |
| Smiles | O=C(c1cc(-c(cc2)ccc2OCCc2ccccc2)n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C27H24N4O2/c32-27(31-28-18-7-12-21-8-3-1-4-9-21)26-20-25(29-30-26)23-13-15-24(16-14-23)33-19-17-22-10-5-2-6-11-22/h1-16,18,20H,17,19H2,(H,29,30)(H,31,32) |
| InChIK | RMDFUIFFTDAOIL-UHFFFAOYSA-N |
| TotalMolweight | 436.514 |
| Molweight | 436.514 |
| MonoisotopicMass | 436.189926 |
| CLogP | 4.6959 |
| CLogS | -5.841 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 358.86 |
| Relative PSA | 0.19777 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 5.0632 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-(2-phenylethoxy)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-[4-(2-phenylethoxy)phenyl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide