| MolName | 2,6-dimorpholin-4-yl-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine |
| MolecularFormula | C20H23N7O6 |
| Smiles | [O-][N+](c1c2OCOc2cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)c2)c1)=O |
| InChI | InChI=1S/C20H23N7O6/c28-27(29)15-9-14(10-16-19(15)33-13-32-16)12-21-24-17-11-18(25-1-5-30-6-2-25)23-20(22-17)26-3-7-31-8-4-26/h9-12H,1-8,13H2,(H,22,23,24) |
| InChIK | RMKZQZPSKYPCPO-UHFFFAOYSA-N |
| TotalMolweight | 457.446 |
| Molweight | 457.446 |
| MonoisotopicMass | 457.170983 |
| CLogP | 2.537 |
| CLogS | -4.843 |
| H Acceptors | 13 |
| H Donors | 1 |
| TotalSurfaceArea | 334.37 |
| Relative PSA | 0.36615 |
| PolarSurfaceArea | 139.39 |
| Druglikeness | -1.9339 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 14 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-dimorpholin-4-yl-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine | 2 - 2,6-dimorpholin-4-yl-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine