| MolName | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C17H13N2O3ClS |
| Smiles | O=S(c1ccccc1)(N/N=C\c1ccc(-c(cc2)ccc2Cl)o1)=O |
| InChI | InChI=1S/C17H13ClN2O3S/c18-14-8-6-13(7-9-14)17-11-10-15(23-17)12-19-20-24(21,22)16-4-2-1-3-5-16/h1-12,20H |
| InChIK | RMSJOOGBQKUVOU-UHFFFAOYSA-N |
| TotalMolweight | 360.82 |
| Molweight | 360.82 |
| MonoisotopicMass | 360.03354 |
| CLogP | 3.822 |
| CLogS | -4.112 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 262.69 |
| Relative PSA | 0.24995 |
| PolarSurfaceArea | 80.05 |
| Druglikeness | -0.93444 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide | 2 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]benzenesulfonamide