| MolName | (2S)-2-hydroxy-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C22H20N2O3 |
| Smiles | O[C@H](C(N/N=C\c(cc1)ccc1OCc1ccccc1)=O)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c25-21(19-9-5-2-6-10-19)22(26)24-23-15-17-11-13-20(14-12-17)27-16-18-7-3-1-4-8-18/h1-15,21,25H,16H2,(H,24,26)/t21-/m0/s1 |
| InChIK | RMTALBSDNUFJTA-NRFANRHFSA-N |
| TotalMolweight | 360.412 |
| Molweight | 360.412 |
| MonoisotopicMass | 360.147393 |
| CLogP | 3.4777 |
| CLogS | -4.479 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 289.36 |
| Relative PSA | 0.20428 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.8506 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S)-2-hydroxy-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - (2S)-2-hydroxy-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide