| MolName | N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-2-(2,4,6-tribromophenoxy)acetamide |
| MolecularFormula | C17H12N3O4Br3 |
| Smiles | [O-][N+](c1cccc(/C=C/C=N\NC(COc(c(Br)cc(Br)c2)c2Br)=O)c1)=O |
| InChI | InChI=1S/C17H12Br3N3O4/c18-12-8-14(19)17(15(20)9-12)27-10-16(24)22-21-6-2-4-11-3-1-5-13(7-11)23(25)26/h1-9H,10H2,(H,22,24) |
| InChIK | RNCNBEVVCZIPBF-UHFFFAOYSA-N |
| TotalMolweight | 562.011 |
| Molweight | 562.011 |
| MonoisotopicMass | 558.83779 |
| CLogP | 4.0488 |
| CLogS | -6.755 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 316.81 |
| Relative PSA | 0.24125 |
| PolarSurfaceArea | 96.51 |
| Druglikeness | -2.6267 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-2-(2,4,6-tribromophenoxy)acetamide | 2 - N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]-2-(2,4,6-tribromophenoxy)acetamide