| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C25H20N8O3 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cc(OCc3ccccc3)ccc2)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H20N8O3/c26-23-24(31-36-30-23)33-22(19-11-5-2-6-12-19)21(28-32-33)25(34)29-27-15-18-10-7-13-20(14-18)35-16-17-8-3-1-4-9-17/h1-15H,16H2,(H2,26,30)(H,29,34) |
| InChIK | RNNMIYQLNNRSPB-UHFFFAOYSA-N |
| TotalMolweight | 480.487 |
| Molweight | 480.487 |
| MonoisotopicMass | 480.165837 |
| CLogP | 4.7937 |
| CLogS | -4.547 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 372.48 |
| Relative PSA | 0.33865 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 1.7208 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide