| MolName | 6-(azepan-1-yl)-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H22N8O2Cl2 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(N/N=C\c(c(Cl)ccc2)c2Cl)nc(N2CCCCCC2)n1)=O |
| InChI | InChI=1S/C22H22Cl2N8O2/c23-18-6-5-7-19(24)17(18)14-25-30-21-27-20(26-15-8-10-16(11-9-15)32(33)34)28-22(29-21)31-12-3-1-2-4-13-31/h5-11,14H,1-4,12-13H2,(H2,26,27,28,29,30) |
| InChIK | RNRJNVXAHODQQH-UHFFFAOYSA-N |
| TotalMolweight | 501.377 |
| Molweight | 501.377 |
| MonoisotopicMass | 500.124276 |
| CLogP | 6.7471 |
| CLogS | -8.107 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 370.61 |
| Relative PSA | 0.27336 |
| PolarSurfaceArea | 124.15 |
| Druglikeness | -4.9087 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-(azepan-1-yl)-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine | 2 - 6-(azepan-1-yl)-2-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine