| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-2-(trifluoromethyl)aniline |
| MolecularFormula | C14H10N2F4 |
| Smiles | FC(c(cccc1)c1N/N=C\c(cccc1)c1F)(F)F |
| InChI | InChI=1S/C14H10F4N2/c15-12-7-3-1-5-10(12)9-19-20-13-8-4-2-6-11(13)14(16,17)18/h1-9,20H |
| InChIK | RNZNSVFFKFZJMZ-UHFFFAOYSA-N |
| TotalMolweight | 282.239 |
| Molweight | 282.239 |
| MonoisotopicMass | 282.07801 |
| CLogP | 5.79 |
| CLogS | -4.241 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 205.05 |
| Relative PSA | 0.11202 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | -4.7675 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-(trifluoromethyl)aniline | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-2-(trifluoromethyl)aniline