| MolName | 2-[(Z)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione |
| MolecularFormula | C21H14N2O2 |
| Smiles | O=C(c(cccc1)c1C1=O)N1/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H14N2O2/c24-20-18-8-4-5-9-19(18)21(25)23(20)22-14-15-10-12-17(13-11-15)16-6-2-1-3-7-16/h1-14H |
| InChIK | ROGJYQQYCMEEOI-UHFFFAOYSA-N |
| TotalMolweight | 326.354 |
| Molweight | 326.354 |
| MonoisotopicMass | 326.105528 |
| CLogP | 4.3109 |
| CLogS | -5.668 |
| H Acceptors | 4 |
| TotalSurfaceArea | 249.84 |
| Relative PSA | 0.16467 |
| PolarSurfaceArea | 49.74 |
| Druglikeness | 3.8425 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione | 2 - 2-[(Z)-(4-phenylphenyl)methylideneamino]isoindole-1,3-dione