| MolName | N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C20H18N2O3S |
| Smiles | O=S(c1ccccc1)(N/N=C\c1cc(OCc2ccccc2)ccc1)=O |
| InChI | InChI=1S/C20H18N2O3S/c23-26(24,20-12-5-2-6-13-20)22-21-15-18-10-7-11-19(14-18)25-16-17-8-3-1-4-9-17/h1-15,22H,16H2 |
| InChIK | ROHMQNRVYUDJSJ-UHFFFAOYSA-N |
| TotalMolweight | 366.44 |
| Molweight | 366.44 |
| MonoisotopicMass | 366.103813 |
| CLogP | 3.6252 |
| CLogS | -3.257 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 281.34 |
| Relative PSA | 0.21877 |
| PolarSurfaceArea | 76.14 |
| Druglikeness | -10.6 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide