| MolName | N-[(Z)-thiophen-2-ylmethylideneamino]aniline |
| MolecularFormula | C11H10N2S |
| Smiles | C(c1cccs1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C11H10N2S/c1-2-5-10(6-3-1)13-12-9-11-7-4-8-14-11/h1-9,13H |
| InChIK | ROJRSTYMUAGWKC-UHFFFAOYSA-N |
| TotalMolweight | 202.28 |
| Molweight | 202.28 |
| MonoisotopicMass | 202.056468 |
| CLogP | 4.7075 |
| CLogS | -3.159 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 165.18 |
| Relative PSA | 0.26232 |
| PolarSurfaceArea | 52.63 |
| Druglikeness | 4.1048 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-2-ylmethylideneamino]aniline | 2 - N-[(Z)-thiophen-2-ylmethylideneamino]aniline