| MolName | (Z)-1-(2,4-difluorophenyl)-N-piperidin-1-ylmethanimine |
| MolecularFormula | C12H14N2F2 |
| Smiles | Fc1cc(F)c(/C=N\N2CCCCC2)cc1 |
| InChI | InChI=1S/C12H14F2N2/c13-11-5-4-10(12(14)8-11)9-15-16-6-2-1-3-7-16/h4-5,8-9H,1-3,6-7H2 |
| InChIK | ROLMKFSXDVARIR-UHFFFAOYSA-N |
| TotalMolweight | 224.253 |
| Molweight | 224.253 |
| MonoisotopicMass | 224.112504 |
| CLogP | 2.8571 |
| CLogS | -3.348 |
| H Acceptors | 2 |
| TotalSurfaceArea | 176.32 |
| Relative PSA | 0.085413 |
| PolarSurfaceArea | 15.6 |
| Druglikeness | 0.8572 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2,4-difluorophenyl)-N-piperidin-1-ylmethanimine | 2 - (Z)-1-(2,4-difluorophenyl)-N-piperidin-1-ylmethanimine