| MolName | 3-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C10H9N7O4 |
| Smiles | Nn1c(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)nnc1 |
| InChI | InChI=1S/C10H9N7O4/c11-16-4-13-15-10(16)14-12-3-6-1-8-9(21-5-20-8)2-7(6)17(18)19/h1-4H,5,11H2,(H,14,15) |
| InChIK | ROMYPADPDOVCQK-UHFFFAOYSA-N |
| TotalMolweight | 291.226 |
| Molweight | 291.226 |
| MonoisotopicMass | 291.071603 |
| CLogP | 2.2891 |
| CLogS | -5.925 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 208.41 |
| Relative PSA | 0.56365 |
| PolarSurfaceArea | 145.4 |
| Druglikeness | -3.4161 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine