| MolName | N-[(Z)-[1-(2-amino-2-oxoethyl)-4-phenylpyrazol-3-yl]methylideneamino]-3-fluorobenzamide |
| MolecularFormula | C19H16N5O2F |
| Smiles | NC(Cn1nc(/C=N\NC(c2cccc(F)c2)=O)c(-c2ccccc2)c1)=O |
| InChI | InChI=1S/C19H16FN5O2/c20-15-8-4-7-14(9-15)19(27)23-22-10-17-16(13-5-2-1-3-6-13)11-25(24-17)12-18(21)26/h1-11H,12H2,(H2,21,26)(H,23,27) |
| InChIK | RONWOBYMQXULTE-UHFFFAOYSA-N |
| TotalMolweight | 365.367 |
| Molweight | 365.367 |
| MonoisotopicMass | 365.128803 |
| CLogP | 1.6598 |
| CLogS | -4.468 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 281.09 |
| Relative PSA | 0.29229 |
| PolarSurfaceArea | 102.37 |
| Druglikeness | 6.0146 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(2-amino-2-oxoethyl)-4-phenylpyrazol-3-yl]methylideneamino]-3-fluorobenzamide | 2 - N-[(Z)-[1-(2-amino-2-oxoethyl)-4-phenylpyrazol-3-yl]methylideneamino]-3-fluorobenzamide