| MolName | 6-chloro-N-[(Z)-(4-chlorophenyl)methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C14H10N4Cl2 |
| Smiles | Clc1ccc(/C=N\Nc2nc(ccc(Cl)c3)c3[nH]2)cc1 |
| InChI | InChI=1S/C14H10Cl2N4/c15-10-3-1-9(2-4-10)8-17-20-14-18-12-6-5-11(16)7-13(12)19-14/h1-8H,(H2,18,19,20) |
| InChIK | ROROREBKJMMDHZ-UHFFFAOYSA-N |
| TotalMolweight | 305.167 |
| Molweight | 305.167 |
| MonoisotopicMass | 304.02825 |
| CLogP | 6.022 |
| CLogS | -5.103 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 223.01 |
| Relative PSA | 0.21492 |
| PolarSurfaceArea | 53.07 |
| Druglikeness | 3.2477 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N-[(Z)-(4-chlorophenyl)methylideneamino]-1H-benzimidazol-2-amine | 2 - 6-chloro-N-[(Z)-(4-chlorophenyl)methylideneamino]-1H-benzimidazol-2-amine