| MolName | [2,4-dibromo-6-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C22H13N2O4Br3ClI |
| Smiles | O=C(COc(ccc(Cl)c1)c1Br)N/N=C\c1cc(Br)cc(Br)c1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C22H13Br3ClIN2O4/c23-13-7-12(10-28-29-20(30)11-32-19-6-5-14(26)9-16(19)24)21(17(25)8-13)33-22(31)15-3-1-2-4-18(15)27/h1-10H,11H2,(H,29,30) |
| InChIK | RORQVBWFWNBQHK-UHFFFAOYSA-N |
| TotalMolweight | 771.42 |
| Molweight | 771.42 |
| MonoisotopicMass | 767.715866 |
| CLogP | 7.4257 |
| CLogS | -9.225 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 395.85 |
| Relative PSA | 0.17443 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.6811 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate