| MolName | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3,4-dichlorophenyl)methylideneamino]thiourea |
| MolecularFormula | C18H17N4O3Cl3S2 |
| Smiles | O=S(c(cc1)cc(NC(N/N=C\c(cc2)cc(Cl)c2Cl)=S)c1Cl)(N1CCOCC1)=O |
| InChI | InChI=1S/C18H17Cl3N4O3S2/c19-14-3-1-12(9-16(14)21)11-22-24-18(29)23-17-10-13(2-4-15(17)20)30(26,27)25-5-7-28-8-6-25/h1-4,9-11H,5-8H2,(H2,23,24,29) |
| InChIK | ROVIYNOZKGIDNQ-UHFFFAOYSA-N |
| TotalMolweight | 507.849 |
| Molweight | 507.849 |
| MonoisotopicMass | 505.980762 |
| CLogP | 4.453 |
| CLogS | -5.735 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.09 |
| Relative PSA | 0.29867 |
| PolarSurfaceArea | 123.5 |
| Druglikeness | 3.921 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3,4-dichlorophenyl)methylideneamino]thiourea | 2 - 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3,4-dichlorophenyl)methylideneamino]thiourea