| MolName | 1-phenyl-N-[(E)-2-phenylethenyl]methanimine |
| MolecularFormula | C15H13N |
| Smiles | C(c1ccccc1)=C/N=C/c1ccccc1 |
| InChI | InChI=1S/C15H13N/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15/h1-13H/b12-11?,16-13+ |
| InChIK | ROYNKBMUUQPQDQ-KEAOUZBJSA-N |
| TotalMolweight | 207.275 |
| Molweight | 207.275 |
| MonoisotopicMass | 207.104799 |
| CLogP | 3.45 |
| CLogS | -4.018 |
| H Acceptors | 1 |
| TotalSurfaceArea | 184.28 |
| Relative PSA | 0.062459 |
| PolarSurfaceArea | 12.36 |
| Druglikeness | -0.15092 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 1 |
| Electronegative Atoms | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-phenyl-N-[(E)-2-phenylethenyl]methanimine | 2 - 1-phenyl-N-[(E)-2-phenylethenyl]methanimine