| MolName | 2-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]benzoate |
| MolecularFormula | C15H10N2O3Br |
| Smiles | [O-]C(c1c(/C=N\NC(c(cccc2)c2Br)=O)cccc1)=O |
| InChI | InChI=1S/C15H11BrN2O3/c16-13-8-4-3-7-12(13)14(19)18-17-9-10-5-1-2-6-11(10)15(20)21/h1-9H,(H,18,19)(H,20,21)/p-1 |
| InChIK | RPLVSSRSRVNDNU-UHFFFAOYSA-M |
| TotalMolweight | 346.159 |
| Molweight | 346.159 |
| MonoisotopicMass | 344.987479 |
| CLogP | 1.3359 |
| CLogS | -4.568 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 230.9 |
| Relative PSA | 0.27427 |
| PolarSurfaceArea | 81.59 |
| Druglikeness | 2.6458 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]benzoate | 2 - 2-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]benzoate