| MolName | N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C23H17N5O6 |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C23H17N5O6/c29-22(18-4-2-1-3-5-18)25-21(14-16-6-10-19(11-7-16)27(31)32)23(30)26-24-15-17-8-12-20(13-9-17)28(33)34/h1-15H,(H,25,29)(H,26,30) |
| InChIK | RPSBEWHXMXSCHJ-UHFFFAOYSA-N |
| TotalMolweight | 459.417 |
| Molweight | 459.417 |
| MonoisotopicMass | 459.117885 |
| CLogP | 2.9751 |
| CLogS | -6.386 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 348.01 |
| Relative PSA | 0.3487 |
| PolarSurfaceArea | 162.2 |
| Druglikeness | 1.2988 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide