| MolName | (Z)-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidenehydrazine |
| MolecularFormula | C20H16N4 |
| Smiles | N/N=C\c1cn(-c2ccccc2)nc1-c1cc2ccccc2cc1 |
| InChI | InChI=1S/C20H16N4/c21-22-13-18-14-24(19-8-2-1-3-9-19)23-20(18)17-11-10-15-6-4-5-7-16(15)12-17/h1-14H,21H2 |
| InChIK | RPSCOJAWBCQGKL-UHFFFAOYSA-N |
| TotalMolweight | 312.375 |
| Molweight | 312.375 |
| MonoisotopicMass | 312.137496 |
| CLogP | 3.6802 |
| CLogS | -5.512 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 248.62 |
| Relative PSA | 0.17947 |
| PolarSurfaceArea | 56.2 |
| Druglikeness | 1.4875 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidenehydrazine | 2 - (Z)-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidenehydrazine