| MolName | 3-[(Z)-[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| MolecularFormula | C21H28N6O |
| Smiles | Oc1cc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)c2)ccc1 |
| InChI | InChI=1S/C21H28N6O/c28-18-9-7-8-17(14-18)16-22-25-19-15-20(26-10-3-1-4-11-26)24-21(23-19)27-12-5-2-6-13-27/h7-9,14-16,28H,1-6,10-13H2,(H,23,24,25) |
| InChIK | RPUOELWTBREXST-UHFFFAOYSA-N |
| TotalMolweight | 380.494 |
| Molweight | 380.494 |
| MonoisotopicMass | 380.232459 |
| CLogP | 5.6703 |
| CLogS | -5.154 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 304.31 |
| Relative PSA | 0.21396 |
| PolarSurfaceArea | 76.88 |
| Druglikeness | 2.6841 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[[2,6-di(piperidin-1-yl)pyrimidin-4-yl]hydrazinylidene]methyl]phenol