| MolName | 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C18H17N3O3 |
| Smiles | O=C(CNc(cc1)cc2c1OCO2)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C18H17N3O3/c22-18(21-20-10-4-7-14-5-2-1-3-6-14)12-19-15-8-9-16-17(11-15)24-13-23-16/h1-11,19H,12-13H2,(H,21,22) |
| InChIK | RPWWYMLDVZAUIG-UHFFFAOYSA-N |
| TotalMolweight | 323.351 |
| Molweight | 323.351 |
| MonoisotopicMass | 323.126992 |
| CLogP | 2.6232 |
| CLogS | -4.546 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 258.97 |
| Relative PSA | 0.26053 |
| PolarSurfaceArea | 71.95 |
| Druglikeness | 4.9129 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide