| MolName | 2-hydroxy-N-[(Z)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]benzamide |
| MolecularFormula | C21H13N5O6S2 |
| Smiles | [O-][N+](c(cc1)cc2c1nc(Sc(ccc(/C=N\NC(c(cccc1)c1O)=O)c1)c1[N+]([O-])=O)s2)=O |
| InChI | InChI=1S/C21H13N5O6S2/c27-17-4-2-1-3-14(17)20(28)24-22-11-12-5-8-18(16(9-12)26(31)32)33-21-23-15-7-6-13(25(29)30)10-19(15)34-21/h1-11,27H,(H,24,28) |
| InChIK | RPXZBSGQROYQLF-UHFFFAOYSA-N |
| TotalMolweight | 495.495 |
| Molweight | 495.495 |
| MonoisotopicMass | 495.030725 |
| CLogP | 3.3357 |
| CLogS | -6.967 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 347.23 |
| Relative PSA | 0.45725 |
| PolarSurfaceArea | 219.76 |
| Druglikeness | -0.52872 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]benzamide