| MolName | 2-[2-[(E)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid |
| MolecularFormula | C14H12N4O4 |
| Smiles | OC(COc1c(/C=N/NC(c2nccnc2)=O)cccc1)=O |
| InChI | InChI=1S/C14H12N4O4/c19-13(20)9-22-12-4-2-1-3-10(12)7-17-18-14(21)11-8-15-5-6-16-11/h1-8H,9H2,(H,18,21)(H,19,20) |
| InChIK | RQCYNGSZJCYVNW-UHFFFAOYSA-N |
| TotalMolweight | 300.273 |
| Molweight | 300.273 |
| MonoisotopicMass | 300.085856 |
| CLogP | 0.3138 |
| CLogS | -1.948 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 232.37 |
| Relative PSA | 0.40491 |
| PolarSurfaceArea | 113.77 |
| Druglikeness | 4.197 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(E)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid | 2 - 2-[2-[(E)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid