| MolName | 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C20H14N6S3 |
| Smiles | S=C(NN=C1c2cccs2)N1/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C20H14N6S3/c27-20-23-22-19(17-9-5-11-29-17)26(20)21-12-14-13-25(15-6-2-1-3-7-15)24-18(14)16-8-4-10-28-16/h1-13H,(H,23,27) |
| InChIK | RQEAZYGFPYYARZ-UHFFFAOYSA-N |
| TotalMolweight | 434.571 |
| Molweight | 434.571 |
| MonoisotopicMass | 434.044204 |
| CLogP | 4.1041 |
| CLogS | -5.895 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 321.08 |
| Relative PSA | 0.38803 |
| PolarSurfaceArea | 146.38 |
| Druglikeness | 5.6652 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione