| MolName | 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-(thiophen-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C21H16N6O2S |
| Smiles | Nc1c(C(NCc2cccs2)=O)c2nc3ccccc3nc2n1/N=C\c1ccco1 |
| InChI | InChI=1S/C21H16N6O2S/c22-19-17(21(28)23-12-14-6-4-10-30-14)18-20(26-16-8-2-1-7-15(16)25-18)27(19)24-11-13-5-3-9-29-13/h1-11H,12,22H2,(H,23,28) |
| InChIK | RQFMNDXCYSVHAI-UHFFFAOYSA-N |
| TotalMolweight | 416.464 |
| Molweight | 416.464 |
| MonoisotopicMass | 416.105544 |
| CLogP | 2.9271 |
| CLogS | -8.052 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 310.58 |
| Relative PSA | 0.36886 |
| PolarSurfaceArea | 139.57 |
| Druglikeness | 6.9585 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-(thiophen-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(Z)-furan-2-ylmethylideneamino]-N-(thiophen-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide