| MolName | 1,3-bis[(Z)-(2-chlorophenyl)methylideneamino]urea |
| MolecularFormula | C15H12N4OCl2 |
| Smiles | O=C(N/N=C\c(cccc1)c1Cl)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C15H12Cl2N4O/c16-13-7-3-1-5-11(13)9-18-20-15(22)21-19-10-12-6-2-4-8-14(12)17/h1-10H,(H2,20,21,22) |
| InChIK | RQJZRYQANFTPKN-UHFFFAOYSA-N |
| TotalMolweight | 335.193 |
| Molweight | 335.193 |
| MonoisotopicMass | 334.038815 |
| CLogP | 4.802 |
| CLogS | -6.302 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 254.05 |
| Relative PSA | 0.23216 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 3.4846 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - 1,3-bis[(Z)-(2-chlorophenyl)methylideneamino]urea | 2 - 1,3-bis[(Z)-(2-chlorophenyl)methylideneamino]urea