| MolName | (2Z)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C21H14N2OCl2 |
| Smiles | O=C(/C(/c1ccccc1)=N\N=C/c(ccc(Cl)c1)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2N2O/c22-18-12-11-17(19(23)13-18)14-24-25-20(15-7-3-1-4-8-15)21(26)16-9-5-2-6-10-16/h1-14H |
| InChIK | RQNLDQWZPPIVND-UHFFFAOYSA-N |
| TotalMolweight | 381.261 |
| Molweight | 381.261 |
| MonoisotopicMass | 380.048317 |
| CLogP | 6.4891 |
| CLogS | -7.28 |
| H Acceptors | 3 |
| TotalSurfaceArea | 289.1 |
| Relative PSA | 0.12473 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | 2.8181 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2Z)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone