| MolName | [4-[(Z)-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C25H17N3O4Cl2S |
| Smiles | O=C(CNC(c(sc1c2cccc1)c2Cl)=O)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C25H17Cl2N3O4S/c26-19-7-3-1-5-17(19)25(33)34-16-11-9-15(10-12-16)13-29-30-21(31)14-28-24(32)23-22(27)18-6-2-4-8-20(18)35-23/h1-13H,14H2,(H,28,32)(H,30,31) |
| InChIK | RQSVGSKAPAQALI-UHFFFAOYSA-N |
| TotalMolweight | 526.399 |
| Molweight | 526.399 |
| MonoisotopicMass | 525.031681 |
| CLogP | 5.849 |
| CLogS | -7.779 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 378.85 |
| Relative PSA | 0.27428 |
| PolarSurfaceArea | 125.1 |
| Druglikeness | 6.3794 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-[(Z)-[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate