| MolName | 1-benzyl-N-[(Z)-(4-bromophenyl)methylideneamino]pyridin-1-ium-3-carboxamide |
| MolecularFormula | C20H17N3OBr |
| Smiles | O=C(c1c[n+](Cc2ccccc2)ccc1)N/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C20H16BrN3O/c21-19-10-8-16(9-11-19)13-22-23-20(25)18-7-4-12-24(15-18)14-17-5-2-1-3-6-17/h1-13,15H,14H2/p+1 |
| InChIK | RQYMZYUCBYPNLD-UHFFFAOYSA-O |
| TotalMolweight | 395.279 |
| Molweight | 395.279 |
| MonoisotopicMass | 394.055498 |
| CLogP | 0.3598 |
| CLogS | -4.213 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 276.44 |
| Relative PSA | 0.14025 |
| PolarSurfaceArea | 45.34 |
| Druglikeness | 2.277 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-benzyl-N-[(Z)-(4-bromophenyl)methylideneamino]pyridin-1-ium-3-carboxamide | 2 - 1-benzyl-N-[(Z)-(4-bromophenyl)methylideneamino]pyridin-1-ium-3-carboxamide