| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-4-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]benzamide |
| MolecularFormula | C29H22N4O |
| Smiles | O=C(c(cc1)ccc1N/N=C\c1cccc2ccccc12)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C29H22N4O/c34-29(33-31-20-25-12-6-10-22-8-2-4-14-28(22)25)23-15-17-26(18-16-23)32-30-19-24-11-5-9-21-7-1-3-13-27(21)24/h1-20,32H,(H,33,34) |
| InChIK | RRANDRNGYGXGRJ-UHFFFAOYSA-N |
| TotalMolweight | 442.521 |
| Molweight | 442.521 |
| MonoisotopicMass | 442.179361 |
| CLogP | 8.7717 |
| CLogS | -8.466 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 352.17 |
| Relative PSA | 0.16748 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 4.4687 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-4-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]benzamide | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-4-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]benzamide