| MolName | N-(3-morpholin-4-ylpropyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
| MolecularFormula | C14H20N4O3S |
| Smiles | O=C(C(N/N=C\c1cccs1)=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C14H20N4O3S/c19-13(14(20)17-16-11-12-3-1-10-22-12)15-4-2-5-18-6-8-21-9-7-18/h1,3,10-11H,2,4-9H2,(H,15,19)(H,17,20) |
| InChIK | RRGQHQIVVQKRLG-UHFFFAOYSA-N |
| TotalMolweight | 324.404 |
| Molweight | 324.404 |
| MonoisotopicMass | 324.125611 |
| CLogP | 0.425 |
| CLogS | -1.788 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 255.5 |
| Relative PSA | 0.36955 |
| PolarSurfaceArea | 111.27 |
| Druglikeness | 6.307 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-morpholin-4-ylpropyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide | 2 - N-(3-morpholin-4-ylpropyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide