| MolName | 2-(2-fluorophenoxy)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide |
| MolecularFormula | C19H20N3O3F |
| Smiles | O=C(COc(cccc1)c1F)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H20FN3O3/c20-17-3-1-2-4-18(17)26-14-19(24)22-21-13-15-5-7-16(8-6-15)23-9-11-25-12-10-23/h1-8,13H,9-12,14H2,(H,22,24) |
| InChIK | RRWRSNFPTMTYKX-UHFFFAOYSA-N |
| TotalMolweight | 357.384 |
| Molweight | 357.384 |
| MonoisotopicMass | 357.14887 |
| CLogP | 2.5463 |
| CLogS | -3.918 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 278.94 |
| Relative PSA | 0.21352 |
| PolarSurfaceArea | 63.16 |
| Druglikeness | 3.9217 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-fluorophenoxy)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide | 2 - 2-(2-fluorophenoxy)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide