| MolName | [4-bromo-2-[(Z)-[(5-chloro-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C21H13N2O4BrCl2 |
| Smiles | Oc(ccc(Cl)c1)c1C(N/N=C\c(cc(cc1)Br)c1OC(c(cccc1)c1Cl)=O)=O |
| InChI | InChI=1S/C21H13BrCl2N2O4/c22-13-5-8-19(30-21(29)15-3-1-2-4-17(15)24)12(9-13)11-25-26-20(28)16-10-14(23)6-7-18(16)27/h1-11,27H,(H,26,28) |
| InChIK | RRZHBHBRDYYSSJ-UHFFFAOYSA-N |
| TotalMolweight | 508.154 |
| Molweight | 508.154 |
| MonoisotopicMass | 505.943573 |
| CLogP | 6.2236 |
| CLogS | -7.201 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 330.32 |
| Relative PSA | 0.21842 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 2.2544 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(5-chloro-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-bromo-2-[(Z)-[(5-chloro-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate