| MolName | N-[(Z)-(3-bromophenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C13H11N2O2BrS |
| Smiles | O=S(c1ccccc1)(N/N=C\c1cccc(Br)c1)=O |
| InChI | InChI=1S/C13H11BrN2O2S/c14-12-6-4-5-11(9-12)10-15-16-19(17,18)13-7-2-1-3-8-13/h1-10,16H |
| InChIK | RSBSJVPEAMDONA-UHFFFAOYSA-N |
| TotalMolweight | 339.212 |
| Molweight | 339.212 |
| MonoisotopicMass | 337.972459 |
| CLogP | 3.0023 |
| CLogS | -2.75 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 216.45 |
| Relative PSA | 0.23816 |
| PolarSurfaceArea | 66.91 |
| Druglikeness | -8.4364 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-bromophenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(3-bromophenyl)methylideneamino]benzenesulfonamide