| MolName | 2,3,4,5,6-pentafluoro-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]aniline |
| MolecularFormula | C18H8N2OF8 |
| Smiles | FC(c1cccc(-c2ccc(/C=N\Nc(c(F)c(c(F)c3F)F)c3F)o2)c1)(F)F |
| InChI | InChI=1S/C18H8F8N2O/c19-12-13(20)15(22)17(16(23)14(12)21)28-27-7-10-4-5-11(29-10)8-2-1-3-9(6-8)18(24,25)26/h1-7,28H |
| InChIK | RSFSKGADGCACJG-UHFFFAOYSA-N |
| TotalMolweight | 420.259 |
| Molweight | 420.259 |
| MonoisotopicMass | 420.050887 |
| CLogP | 7.1321 |
| CLogS | -6.957 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 279.9 |
| Relative PSA | 0.13248 |
| PolarSurfaceArea | 37.53 |
| Druglikeness | -2.8155 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2,3,4,5,6-pentafluoro-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]aniline | 2 - 2,3,4,5,6-pentafluoro-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]aniline