| MolName | N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide |
| MolecularFormula | C19H14N3O5Cl |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c1ccc(-c(cccc2)c2Cl)o1)=O)=O |
| InChI | InChI=1S/C19H14ClN3O5/c20-15-6-2-1-5-14(15)17-10-9-13(28-17)11-21-22-19(24)12-27-18-8-4-3-7-16(18)23(25)26/h1-11H,12H2,(H,22,24) |
| InChIK | RSHPMYKXUBLXQW-UHFFFAOYSA-N |
| TotalMolweight | 399.789 |
| Molweight | 399.789 |
| MonoisotopicMass | 399.062199 |
| CLogP | 3.3998 |
| CLogS | -6.157 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 299.29 |
| Relative PSA | 0.30252 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | 1.3799 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide | 2 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide