| MolName | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]prop-1-en-2-yl]furan-2-carboxamide |
| MolecularFormula | C24H19N3O5 |
| Smiles | O=C(/C(/NC(c1ccco1)=O)=C/c(cc1)cc2c1OCO2)N/N=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C24H19N3O5/c28-23(27-25-12-4-8-17-6-2-1-3-7-17)19(26-24(29)21-9-5-13-30-21)14-18-10-11-20-22(15-18)32-16-31-20/h1-15H,16H2,(H,26,29)(H,27,28) |
| InChIK | RSJAEYBOEFECIE-UHFFFAOYSA-N |
| TotalMolweight | 429.431 |
| Molweight | 429.431 |
| MonoisotopicMass | 429.132472 |
| CLogP | 4.1367 |
| CLogS | -6.151 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 337.12 |
| Relative PSA | 0.28067 |
| PolarSurfaceArea | 102.16 |
| Druglikeness | 6.0912 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]prop-1-en-2-yl]furan-2-carboxamide | 2 - N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]prop-1-en-2-yl]furan-2-carboxamide