| MolName | N-[(Z)-(3-phenoxyphenyl)methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C24H18N2O2 |
| Smiles | O=C(c1cc2ccccc2cc1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C24H18N2O2/c27-24(21-14-13-19-8-4-5-9-20(19)16-21)26-25-17-18-7-6-12-23(15-18)28-22-10-2-1-3-11-22/h1-17H,(H,26,27) |
| InChIK | RSNKTOXHPJPOGE-UHFFFAOYSA-N |
| TotalMolweight | 366.419 |
| Molweight | 366.419 |
| MonoisotopicMass | 366.136828 |
| CLogP | 5.7916 |
| CLogS | -7.624 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 291.35 |
| Relative PSA | 0.15792 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.3193 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]naphthalene-2-carboxamide | 2 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]naphthalene-2-carboxamide