| MolName | 2-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H24N7OCl |
| Smiles | Clc(cccc1)c1-c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(Nc3ccccc3)n2)o1 |
| InChI | InChI=1S/C25H24ClN7O/c26-21-12-6-5-11-20(21)22-14-13-19(34-22)17-27-32-24-29-23(28-18-9-3-1-4-10-18)30-25(31-24)33-15-7-2-8-16-33/h1,3-6,9-14,17H,2,7-8,15-16H2,(H2,28,29,30,31,32) |
| InChIK | RTFCDNZHFUZJQX-UHFFFAOYSA-N |
| TotalMolweight | 473.967 |
| Molweight | 473.967 |
| MonoisotopicMass | 473.173085 |
| CLogP | 8.1708 |
| CLogS | -8.101 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 367.21 |
| Relative PSA | 0.23148 |
| PolarSurfaceArea | 91.47 |
| Druglikeness | 4.4461 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine