| MolName | 4-(3-nitrophenyl)-N-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C16H9N4O2Cl3S |
| Smiles | [O-][N+](c1cccc(-c2csc(N/N=C\c(c(Cl)c(cc3)Cl)c3Cl)n2)c1)=O |
| InChI | InChI=1S/C16H9Cl3N4O2S/c17-12-4-5-13(18)15(19)11(12)7-20-22-16-21-14(8-26-16)9-2-1-3-10(6-9)23(24)25/h1-8H,(H,21,22) |
| InChIK | RTGZEBQEBUTHQQ-UHFFFAOYSA-N |
| TotalMolweight | 427.698 |
| Molweight | 427.698 |
| MonoisotopicMass | 425.951177 |
| CLogP | 6.9424 |
| CLogS | -7.328 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 293.63 |
| Relative PSA | 0.28853 |
| PolarSurfaceArea | 111.34 |
| Druglikeness | -1.2517 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(3-nitrophenyl)-N-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - 4-(3-nitrophenyl)-N-[(Z)-(2,3,6-trichlorophenyl)methylideneamino]-1,3-thiazol-2-amine