| MolName | 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea |
| MolecularFormula | C20H20N8Cl4S2 |
| Smiles | S=C(NN(CC1)CCN1NC(N/N=C\c(ccc(Cl)c1)c1Cl)=S)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C20H20Cl4N8S2/c21-15-3-1-13(17(23)9-15)11-25-27-19(33)29-31-5-7-32(8-6-31)30-20(34)28-26-12-14-2-4-16(22)10-18(14)24/h1-4,9-12H,5-8H2,(H2,27,29,33)(H2,28,30,34) |
| InChIK | RTKJNDHDNPOUJI-UHFFFAOYSA-N |
| TotalMolweight | 578.379 |
| Molweight | 578.379 |
| MonoisotopicMass | 576.00064 |
| CLogP | 4.0852 |
| CLogS | -7.798 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 417.62 |
| Relative PSA | 0.31598 |
| PolarSurfaceArea | 143.5 |
| Druglikeness | 4.9823 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 18 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea | 2 - 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea