| MolName | 4-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate |
| MolecularFormula | C22H17N2O5 |
| Smiles | [O-]C(c(cc1)ccc1-c1ccc(/C=N\N(C([C@H]2[C@@H](CC3)C=C[C@@H]3[C@@H]22)=O)C2=O)o1)=O |
| InChI | InChI=1S/C22H18N2O5/c25-20-18-13-3-4-14(6-5-13)19(18)21(26)24(20)23-11-16-9-10-17(29-16)12-1-7-15(8-2-12)22(27)28/h1-4,7-11,13-14,18-19H,5-6H2,(H,27,28)/p-1/t13-,14+,18-,19-/m1/s1 |
| InChIK | RTWHMHDTOXWSFN-GTYSZEQSSA-M |
| TotalMolweight | 389.386 |
| Molweight | 389.386 |
| MonoisotopicMass | 389.113748 |
| CLogP | 0.4285 |
| CLogS | -5.011 |
| H Acceptors | 7 |
| TotalSurfaceArea | 282.07 |
| Relative PSA | 0.29273 |
| PolarSurfaceArea | 103.01 |
| Druglikeness | 6.1845 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 4-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate | 2 - 4-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate